C20H42N4O — CID 145206770
(Z)-3-[(Z)-2-amino-3-(5-methylhexylamino)prop-2-enoxy]-1-N-(5-methylhexyl)prop-1-ene-1,2-diamine (PubChem CID 145206770) has the molecular formula C20H42N4O and a molecular weight of 354.58 g/mol. Its IUPAC name is (Z)-3-[(Z)-2-amino-3-(5-methylhexylamino)prop-2-enoxy]-1-N-(5-methylhexyl)prop-1-ene-1,2-diamine.
| Compound Name | (Z)-3-[(Z)-2-amino-3-(5-methylhexylamino)prop-2-enoxy]-1-N-(5-methylhexyl)prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 145206770 |
| Molecular Formula | C20H42N4O |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.34 |
| IUPAC Name | (Z)-3-[(Z)-2-amino-3-(5-methylhexylamino)prop-2-enoxy]-1-N-(5-methylhexyl)prop-1-ene-1,2-diamine |
| SMILES | CC(C)CCCCN/C=C(\N)COC/C(N)=C/NCCCCC(C)C |
| InChI | InChI=1S/C20H42N4O/c1-17(2)9-5-7-11-23-13-19(21)15-25-16-20(22)14-24-12-8-6-10-18(3)4/h13-14,17-18,23-24H,5-12,15-16,21-22H2,1-4H3/b19-13-,20-14- |
| InChIKey | YMKVKPFHUYTLDU-AXPXABNXSA-N |
| XLogP | 3.43 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|