C28H27N5O2 — CID 145206952
N-[[4-[(Z)-N'-methoxycarbamimidoyl]-2-methylphenyl]methyl]-7-pyrazol-1-yl-9,10-dihydroanthracene-2-carboxamide (PubChem CID 145206952) has the molecular formula C28H27N5O2 and a molecular weight of 465.56 g/mol. Its IUPAC name is N-[[4-[(Z)-N'-methoxycarbamimidoyl]-2-methylphenyl]methyl]-7-pyrazol-1-yl-9,10-dihydroanthracene-2-carboxamide.
| Compound Name | N-[[4-[(Z)-N'-methoxycarbamimidoyl]-2-methylphenyl]methyl]-7-pyrazol-1-yl-9,10-dihydroanthracene-2-carboxamide |
|---|---|
| PubChem CID | 145206952 |
| Molecular Formula | C28H27N5O2 |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | N-[[4-[(Z)-N'-methoxycarbamimidoyl]-2-methylphenyl]methyl]-7-pyrazol-1-yl-9,10-dihydroanthracene-2-carboxamide |
| SMILES | CO/N=C(\N)c1ccc(CNC(=O)c2ccc3c(c2)Cc2cc(-n4cccn4)ccc2C3)c(C)c1 |
| InChI | InChI=1S/C28H27N5O2/c1-18-12-21(27(29)32-35-2)5-7-23(18)17-30-28(34)22-6-4-19-13-20-8-9-26(33-11-3-10-31-33)16-25(20)15-24(19)14-22/h3-12,14,16H,13,15,17H2,1-2H3,(H2,29,32)(H,30,34) |
| InChIKey | OENXBIASQDJKIY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|