C32H33ClN4O3 — CID 145206973
7-(3-chloro-N-methylanilino)-N-[[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]methyl]-9,10-dihydroanthracene-2-carboxamide;methanol (PubChem CID 145206973) has the molecular formula C32H33ClN4O3 and a molecular weight of 557.09 g/mol. Its IUPAC name is 7-(3-chloro-N-methylanilino)-N-[[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]methyl]-9,10-dihydroanthracene-2-carboxamide;methanol.
| Compound Name | 7-(3-chloro-N-methylanilino)-N-[[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]methyl]-9,10-dihydroanthracene-2-carboxamide;methanol |
|---|---|
| PubChem CID | 145206973 |
| Molecular Formula | C32H33ClN4O3 |
| Molecular Weight | 557.09 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 7-(3-chloro-N-methylanilino)-N-[[4-[(Z)-N'-methoxycarbamimidoyl]phenyl]methyl]-9,10-dihydroanthracene-2-carboxamide;methanol |
| SMILES | CO.CO/N=C(\N)c1ccc(CNC(=O)c2ccc3c(c2)Cc2cc(N(C)c4cccc(Cl)c4)ccc2C3)cc1 |
| InChI | InChI=1S/C31H29ClN4O2.CH4O/c1-36(28-5-3-4-27(32)18-28)29-13-12-23-14-22-10-11-24(15-25(22)16-26(23)17-29)31(37)34-19-20-6-8-21(9-7-20)30(33)35-38-2;1-2/h3-13,15,17-18H,14,16,19H2,1-2H3,(H2,33,35)(H,34,37);2H,1H3 |
| InChIKey | YDERWPCRLSSFSD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.09 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|