C12H26NO3+ — CID 145208998
[4-(ethoxymethyl)-4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium (PubChem CID 145208998) has the molecular formula C12H26NO3+ and a molecular weight of 232.34 g/mol. Its IUPAC name is [4-(ethoxymethyl)-4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium.
| Compound Name | [4-(ethoxymethyl)-4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
|---|---|
| PubChem CID | 145208998 |
| Molecular Formula | C12H26NO3+ |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | [4-(ethoxymethyl)-4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl]oxidanium |
| SMILES | CCOCC1(O)CC(C)(C)N([OH2+])C(C)(C)C1 |
| InChI | InChI=1S/C12H25NO3/c1-6-16-9-12(14)7-10(2,3)13(15)11(4,5)8-12/h14-15H,6-9H2,1-5H3/p+1 |
| InChIKey | LOIHHICOCSBNKA-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|