C17H17F2N3OS — CID 145209280
5,7-diaminospiro[1H-indole-3,1'-cyclobutane]-2-one;2,4-difluorobenzenethiol (PubChem CID 145209280) has the molecular formula C17H17F2N3OS and a molecular weight of 349.41 g/mol. Its IUPAC name is 5,7-diaminospiro[1H-indole-3,1'-cyclobutane]-2-one;2,4-difluorobenzenethiol.
| Compound Name | 5,7-diaminospiro[1H-indole-3,1'-cyclobutane]-2-one;2,4-difluorobenzenethiol |
|---|---|
| PubChem CID | 145209280 |
| Molecular Formula | C17H17F2N3OS |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5,7-diaminospiro[1H-indole-3,1'-cyclobutane]-2-one;2,4-difluorobenzenethiol |
| SMILES | Fc1ccc(S)c(F)c1.Nc1cc(N)c2c(c1)C1(CCC1)C(=O)N2 |
| InChI | InChI=1S/C11H13N3O.C6H4F2S/c12-6-4-7-9(8(13)5-6)14-10(15)11(7)2-1-3-11;7-4-1-2-6(9)5(8)3-4/h4-5H,1-3,12-13H2,(H,14,15);1-3,9H |
| InChIKey | BWRIADQLKMSOEL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|