C23H32F3N3O6 — CID 145215591
ethyl N-[2-[[(3E)-3-methoxyimino-2-oxo-4-propylpiperidin-1-yl]methyl]phenyl]-N-(2,2,2-trifluoroethyl)carbamate;formaldehyde (PubChem CID 145215591) has the molecular formula C23H32F3N3O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is ethyl N-[2-[[(3E)-3-methoxyimino-2-oxo-4-propylpiperidin-1-yl]methyl]phenyl]-N-(2,2,2-trifluoroethyl)carbamate;formaldehyde.
| Compound Name | ethyl N-[2-[[(3E)-3-methoxyimino-2-oxo-4-propylpiperidin-1-yl]methyl]phenyl]-N-(2,2,2-trifluoroethyl)carbamate;formaldehyde |
|---|---|
| PubChem CID | 145215591 |
| Molecular Formula | C23H32F3N3O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | ethyl N-[2-[[(3E)-3-methoxyimino-2-oxo-4-propylpiperidin-1-yl]methyl]phenyl]-N-(2,2,2-trifluoroethyl)carbamate;formaldehyde |
| SMILES | C=O.C=O.CCCC1CCN(Cc2ccccc2N(CC(F)(F)F)C(=O)OCC)C(=O)/C1=N/OC |
| InChI | InChI=1S/C21H28F3N3O4.2CH2O/c1-4-8-15-11-12-26(19(28)18(15)25-30-3)13-16-9-6-7-10-17(16)27(14-21(22,23)24)20(29)31-5-2;2*1-2/h6-7,9-10,15H,4-5,8,11-14H2,1-3H3;2*1H2/b25-18+;; |
| InChIKey | VRFYQLLPMOQSDG-XZLUVQPVSA-N |
| XLogP | 3.99 |
| TPSA | 105.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|