C18H22F3N3O6S — CID 145215606
ethyl N-[2-[[(3E)-3-methoxyimino-6-methyl-2-oxopiperidin-1-yl]methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate (PubChem CID 145215606) has the molecular formula C18H22F3N3O6S and a molecular weight of 465.45 g/mol. Its IUPAC name is ethyl N-[2-[[(3E)-3-methoxyimino-6-methyl-2-oxopiperidin-1-yl]methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate.
| Compound Name | ethyl N-[2-[[(3E)-3-methoxyimino-6-methyl-2-oxopiperidin-1-yl]methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate |
|---|---|
| PubChem CID | 145215606 |
| Molecular Formula | C18H22F3N3O6S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | ethyl N-[2-[[(3E)-3-methoxyimino-6-methyl-2-oxopiperidin-1-yl]methyl]phenyl]-N-(trifluoromethylsulfonyl)carbamate |
| SMILES | CCOC(=O)N(c1ccccc1CN1C(=O)/C(=N/OC)CCC1C)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H22F3N3O6S/c1-4-30-17(26)24(31(27,28)18(19,20)21)15-8-6-5-7-13(15)11-23-12(2)9-10-14(16(23)25)22-29-3/h5-8,12H,4,9-11H2,1-3H3/b22-14+ |
| InChIKey | QGSPXFRZJDJAQX-HYARGMPZSA-N |
| XLogP | 3.01 |
| TPSA | 105.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|