C11H16N2O3 — CID 145215722
1-[[[2-(2,5-dihydropyrrol-1-yl)acetyl]amino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 145215722) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-[[[2-(2,5-dihydropyrrol-1-yl)acetyl]amino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[[2-(2,5-dihydropyrrol-1-yl)acetyl]amino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 145215722 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-[[[2-(2,5-dihydropyrrol-1-yl)acetyl]amino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(CN1CC=CC1)NCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C11H16N2O3/c14-9(7-13-5-1-2-6-13)12-8-11(3-4-11)10(15)16/h1-2H,3-8H2,(H,12,14)(H,15,16) |
| InChIKey | NJCOZLSBUOEATP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|