C15H26N2O3 — CID 65265337
3-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-2,2,3-trimethylbutanoic acid (PubChem CID 65265337) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 65265337 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-[[2-[bis(prop-2-enyl)amino]-2-oxoethyl]amino]-2,2,3-trimethylbutanoic acid |
| SMILES | C=CCN(CC=C)C(=O)CNC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C15H26N2O3/c1-7-9-17(10-8-2)12(18)11-16-15(5,6)14(3,4)13(19)20/h7-8,16H,1-2,9-11H2,3-6H3,(H,19,20) |
| InChIKey | LWZGCLZBZVICRT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|