C13H22N2O4 — CID 129120073
methyl 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoate (PubChem CID 129120073) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is methyl 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoate.
| Compound Name | methyl 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 129120073 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | methyl 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoate |
| SMILES | C=CC(=O)NCC(=O)NC(C)(C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C13H22N2O4/c1-7-9(16)14-8-10(17)15-13(4,5)12(2,3)11(18)19-6/h7H,1,8H2,2-6H3,(H,14,16)(H,15,17) |
| InChIKey | IOIONUBSFZMGGM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|