C13H22N2O4 — CID 134254854
[2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] formate (PubChem CID 134254854) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] formate.
| Compound Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] formate |
|---|---|
| PubChem CID | 134254854 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] formate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCC(C)(C)COC=O |
| InChI | InChI=1S/C13H22N2O4/c1-6-10(17)15-13(4,5)11(18)14-7-12(2,3)8-19-9-16/h6,9H,1,7-8H2,2-5H3,(H,14,18)(H,15,17) |
| InChIKey | ZSNUPYBCOLLWJB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|