C10H16N2O3 — CID 170637320
2-methyl-N-(3-oxopropyl)-2-(prop-2-enoylamino)propanamide (PubChem CID 170637320) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-methyl-N-(3-oxopropyl)-2-(prop-2-enoylamino)propanamide.
| Compound Name | 2-methyl-N-(3-oxopropyl)-2-(prop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 170637320 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-methyl-N-(3-oxopropyl)-2-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCC=O |
| InChI | InChI=1S/C10H16N2O3/c1-4-8(14)12-10(2,3)9(15)11-6-5-7-13/h4,7H,1,5-6H2,2-3H3,(H,11,15)(H,12,14) |
| InChIKey | WKZPFUXBPXUIOZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|