C8H12N2O3 — CID 91498866
2-methyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]prop-2-enamide (PubChem CID 91498866) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]prop-2-enamide.
| Compound Name | 2-methyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 91498866 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 2-methyl-N-[2-oxo-2-(2-oxoethylamino)ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)NCC(=O)NCC=O |
| InChI | InChI=1S/C8H12N2O3/c1-6(2)8(13)10-5-7(12)9-3-4-11/h4H,1,3,5H2,2H3,(H,9,12)(H,10,13) |
| InChIKey | NKZQJNUPCHAHEN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|