C14H24N2O4 — CID 88855034
[2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] acetate (PubChem CID 88855034) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] acetate.
| Compound Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] acetate |
|---|---|
| PubChem CID | 88855034 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] acetate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCC(C)(C)COC(C)=O |
| InChI | InChI=1S/C14H24N2O4/c1-7-11(18)16-14(5,6)12(19)15-8-13(3,4)9-20-10(2)17/h7H,1,8-9H2,2-6H3,(H,15,19)(H,16,18) |
| InChIKey | NQCOTAOXGYQWHV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|