C15H24N2O6 — CID 126492438
4-O-[3-[[2-(2,2-dimethylpropanoylamino)acetyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 126492438) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-O-[3-[[2-(2,2-dimethylpropanoylamino)acetyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[3-[[2-(2,2-dimethylpropanoylamino)acetyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492438 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-O-[3-[[2-(2,2-dimethylpropanoylamino)acetyl]amino]propyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCCNC(=O)CNC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H24N2O6/c1-15(2,3)14(21)17-10-11(18)16-8-5-9-23-13(20)7-6-12(19)22-4/h6-7H,5,8-10H2,1-4H3,(H,16,18)(H,17,21)/b7-6+ |
| InChIKey | HILUDABHODJKOT-VOTSOKGWSA-N |
| XLogP | -0.07 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|