C10H17N3O4 — CID 88950850
methyl (E)-4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-4-oxobut-2-enoate (PubChem CID 88950850) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is methyl (E)-4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 88950850 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | methyl (E)-4-[2-[[(2S)-2-aminopropanoyl]amino]ethylamino]-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)NCCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C10H17N3O4/c1-7(11)10(16)13-6-5-12-8(14)3-4-9(15)17-2/h3-4,7H,5-6,11H2,1-2H3,(H,12,14)(H,13,16)/b4-3+/t7-/m0/s1 |
| InChIKey | ULNNPRKXOMWZPR-SDLBARTOSA-N |
| XLogP | -1.70 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|