C11H18N2O4 — CID 89273232
ethyl (E)-4-[(2-formamidoacetyl)-methylamino]-2-methylbut-2-enoate (PubChem CID 89273232) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl (E)-4-[(2-formamidoacetyl)-methylamino]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(2-formamidoacetyl)-methylamino]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 89273232 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl (E)-4-[(2-formamidoacetyl)-methylamino]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CN(C)C(=O)CNC=O |
| InChI | InChI=1S/C11H18N2O4/c1-4-17-11(16)9(2)5-6-13(3)10(15)7-12-8-14/h5,8H,4,6-7H2,1-3H3,(H,12,14)/b9-5+ |
| InChIKey | BKUDTJOHLXQSQV-WEVVVXLNSA-N |
| XLogP | -0.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|