C15H26N2O4 — CID 89273397
ethyl (E,4S)-4-[ethyl-(2-formamidoacetyl)amino]-2,5-dimethylhex-2-enoate (PubChem CID 89273397) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (E,4S)-4-[ethyl-(2-formamidoacetyl)amino]-2,5-dimethylhex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[ethyl-(2-formamidoacetyl)amino]-2,5-dimethylhex-2-enoate |
|---|---|
| PubChem CID | 89273397 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | ethyl (E,4S)-4-[ethyl-(2-formamidoacetyl)amino]-2,5-dimethylhex-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@H](C(C)C)N(CC)C(=O)CNC=O |
| InChI | InChI=1S/C15H26N2O4/c1-6-17(14(19)9-16-10-18)13(11(3)4)8-12(5)15(20)21-7-2/h8,10-11,13H,6-7,9H2,1-5H3,(H,16,18)/b12-8+/t13-/m1/s1 |
| InChIKey | FIRHFZGWZACETP-YQCJOKCJSA-N |
| XLogP | 1.11 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|