C15H26N2O3 — CID 118517825
[3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] acetate (PubChem CID 118517825) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] acetate.
| Compound Name | [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 118517825 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | [3-[[2-(buta-1,3-dien-2-ylamino)-2-methylpropanoyl]amino]-2,2-dimethylpropyl] acetate |
| SMILES | C=CC(=C)NC(C)(C)C(=O)NCC(C)(C)COC(C)=O |
| InChI | InChI=1S/C15H26N2O3/c1-8-11(2)17-15(6,7)13(19)16-9-14(4,5)10-20-12(3)18/h8,17H,1-2,9-10H2,3-7H3,(H,16,19) |
| InChIKey | FSEJZIMXTLEXSF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|