C16H28N2O4 — CID 88854709
[2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] 2-methylpropanoate (PubChem CID 88854709) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] 2-methylpropanoate.
| Compound Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 88854709 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [2,2-dimethyl-3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propyl] 2-methylpropanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCC(C)(C)COC(=O)C(C)C |
| InChI | InChI=1S/C16H28N2O4/c1-8-12(19)18-16(6,7)14(21)17-9-15(4,5)10-22-13(20)11(2)3/h8,11H,1,9-10H2,2-7H3,(H,17,21)(H,18,19) |
| InChIKey | DZHDXGWRWFQHCC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|