C11H18N2O4 — CID 134339741
methyl 3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propanoate (PubChem CID 134339741) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is methyl 3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propanoate.
| Compound Name | methyl 3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 134339741 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methyl 3-[[2-methyl-2-(prop-2-enoylamino)propanoyl]amino]propanoate |
| SMILES | C=CC(=O)NC(C)(C)C(=O)NCCC(=O)OC |
| InChI | InChI=1S/C11H18N2O4/c1-5-8(14)13-11(2,3)10(16)12-7-6-9(15)17-4/h5H,1,6-7H2,2-4H3,(H,12,16)(H,13,14) |
| InChIKey | VPCFITXABQWTGQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|