C12H20N2O4 — CID 129120074
2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid (PubChem CID 129120074) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid.
| Compound Name | 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 129120074 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2,2,3-trimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid |
| SMILES | C=CC(=O)NCC(=O)NC(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-6-8(15)13-7-9(16)14-12(4,5)11(2,3)10(17)18/h6H,1,7H2,2-5H3,(H,13,15)(H,14,16)(H,17,18) |
| InChIKey | WPDKRZLHLCZBSD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|