C50H89N3O4 — CID 145219700
[(9Z,12Z)-octadeca-9,12-dienyl] 4-[[2-[[(2R)-2-methylhexyl]amino]acetyl]amino]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate (PubChem CID 145219700) has the molecular formula C50H89N3O4 and a molecular weight of 796.28 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 4-[[2-[[(2R)-2-methylhexyl]amino]acetyl]amino]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 4-[[2-[[(2R)-2-methylhexyl]amino]acetyl]amino]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 145219700 |
| Molecular Formula | C50H89N3O4 |
| Molecular Weight | 796.28 g/mol |
| Exact Mass | 795.69 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 4-[[2-[[(2R)-2-methylhexyl]amino]acetyl]amino]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)C1CC(NC(=O)CNC[C@H](C)CCCC)CN1C(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C50H89N3O4/c1-5-8-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40-57-50(56)47-41-46(52-48(54)43-51-42-45(4)38-10-7-3)44-53(47)49(55)39-36-34-32-30-28-26-24-22-20-18-16-14-12-9-6-2/h15-18,21-24,45-47,51H,5-14,19-20,25-44H2,1-4H3,(H,52,54)/b17-15-,18-16-,23-21-,24-22-/t45-,46?,47?/m1/s1 |
| InChIKey | AZJHKYKZLQUGIG-QONPEQLBSA-N |
| XLogP | 12.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.28 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|