C48H82N2O6 — CID 155015622
[(9Z,12Z)-octadeca-9,12-dienyl] (2S)-4-[3-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-2-oxopropyl]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate (PubChem CID 155015622) has the molecular formula C48H82N2O6 and a molecular weight of 783.19 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-4-[3-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-2-oxopropyl]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-4-[3-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-2-oxopropyl]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 155015622 |
| Molecular Formula | C48H82N2O6 |
| Molecular Weight | 783.19 g/mol |
| Exact Mass | 782.62 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] (2S)-4-[3-[(3R)-3,4-dihydroxypyrrolidin-1-yl]-2-oxopropyl]-1-[(9Z,12Z)-octadeca-9,12-dienoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)[C@@H]1CC(CC(=O)CN2CC(O)[C@H](O)C2)CN1C(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C48H82N2O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-56-48(55)44-37-42(36-43(51)39-49-40-45(52)46(53)41-49)38-50(44)47(54)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,42,44-46,52-53H,3-10,15-16,21-41H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t42?,44-,45+,46?/m0/s1 |
| InChIKey | QNQJDBMCAXLSKW-RVXGZDQCSA-N |
| XLogP | 10.37 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.19 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|