C47H82N2O7 — CID 155015557
bis[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-(3,4-dihydroxypyrrolidin-1-yl)acetyl]amino]pentanedioate (PubChem CID 155015557) has the molecular formula C47H82N2O7 and a molecular weight of 787.18 g/mol. Its IUPAC name is bis[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-(3,4-dihydroxypyrrolidin-1-yl)acetyl]amino]pentanedioate.
| Compound Name | bis[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-(3,4-dihydroxypyrrolidin-1-yl)acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 155015557 |
| Molecular Formula | C47H82N2O7 |
| Molecular Weight | 787.18 g/mol |
| Exact Mass | 786.61 |
| IUPAC Name | bis[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-(3,4-dihydroxypyrrolidin-1-yl)acetyl]amino]pentanedioate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)CN1CC(O)C(O)C1 |
| InChI | InChI=1S/C47H82N2O7/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-55-46(53)37-42(48-45(52)41-49-39-43(50)44(51)40-49)38-47(54)56-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,42-44,50-51H,3-10,15-16,21-41H2,1-2H3,(H,48,52)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | GYDJFZKGYABAIQ-MAZCIEHSSA-N |
| XLogP | 10.00 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.18 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|