C31H55N3O5 — CID 155015560
[(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]amino]-5-oxopentanoate (PubChem CID 155015560) has the molecular formula C31H55N3O5 and a molecular weight of 549.80 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]amino]-5-oxopentanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 155015560 |
| Molecular Formula | C31H55N3O5 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.41 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]acetyl]amino]-5-oxopentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CC(CC=O)NC(=O)CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C31H55N3O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26-39-31(38)27-29(18-24-35)32-30(37)28-34-21-19-33(20-22-34)23-25-36/h6-7,9-10,24,29,36H,2-5,8,11-23,25-28H2,1H3,(H,32,37)/b7-6-,10-9- |
| InChIKey | JVBCGJIEWNHXMO-HZJYTTRNSA-N |
| XLogP | 4.42 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|