C59H112N6O7+2 — CID 118563802
[2-[4-[2-[[1,5-bis[(Z)-octadec-9-enoxy]-1,5-dioxopentan-2-yl]amino]-2-oxoethyl]-7-[2-(trimethylazaniumyl)acetyl]-1,4,7-triazonan-1-yl]-2-oxoethyl]-trimethylazanium (PubChem CID 118563802) has the molecular formula C59H112N6O7+2 and a molecular weight of 1017.58 g/mol. Its IUPAC name is [2-[4-[2-[[1,5-bis[(Z)-octadec-9-enoxy]-1,5-dioxopentan-2-yl]amino]-2-oxoethyl]-7-[2-(trimethylazaniumyl)acetyl]-1,4,7-triazonan-1-yl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[4-[2-[[1,5-bis[(Z)-octadec-9-enoxy]-1,5-dioxopentan-2-yl]amino]-2-oxoethyl]-7-[2-(trimethylazaniumyl)acetyl]-1,4,7-triazonan-1-yl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 118563802 |
| Molecular Formula | C59H112N6O7+2 |
| Molecular Weight | 1017.58 g/mol |
| Exact Mass | 1016.86 |
| IUPAC Name | [2-[4-[2-[[1,5-bis[(Z)-octadec-9-enoxy]-1,5-dioxopentan-2-yl]amino]-2-oxoethyl]-7-[2-(trimethylazaniumyl)acetyl]-1,4,7-triazonan-1-yl]-2-oxoethyl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CCC(NC(=O)CN1CCN(C(=O)C[N+](C)(C)C)CCN(C(=O)C[N+](C)(C)C)CC1)C(=O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C59H111N6O7/c1-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-49-71-58(69)42-41-54(59(70)72-50-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-2)60-55(66)51-61-43-45-62(56(67)52-64(3,4)5)47-48-63(46-44-61)57(68)53-65(6,7)8/h23-26,54H,9-22,27-53H2,1-8H3/q+1/p+1/b25-23-,26-24- |
| InChIKey | IDZJRGSAVUOGRF-YPAXQUSRSA-O |
| XLogP | 10.80 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.58 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|