C50H94N4O5 — CID 126556321
1-O-[(Z)-nonadec-9-enyl] 5-O-[(Z)-octadec-9-enyl] 2-[[2-(1,4,7-triazonan-1-yl)acetyl]amino]pentanedioate (PubChem CID 126556321) has the molecular formula C50H94N4O5 and a molecular weight of 831.32 g/mol. Its IUPAC name is 1-O-[(Z)-nonadec-9-enyl] 5-O-[(Z)-octadec-9-enyl] 2-[[2-(1,4,7-triazonan-1-yl)acetyl]amino]pentanedioate.
| Compound Name | 1-O-[(Z)-nonadec-9-enyl] 5-O-[(Z)-octadec-9-enyl] 2-[[2-(1,4,7-triazonan-1-yl)acetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 126556321 |
| Molecular Formula | C50H94N4O5 |
| Molecular Weight | 831.32 g/mol |
| Exact Mass | 830.72 |
| IUPAC Name | 1-O-[(Z)-nonadec-9-enyl] 5-O-[(Z)-octadec-9-enyl] 2-[[2-(1,4,7-triazonan-1-yl)acetyl]amino]pentanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CCC(NC(=O)CN1CCNCCNCC1)C(=O)OCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C50H94N4O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-45-59-50(57)47(53-48(55)46-54-42-40-51-38-39-52-41-43-54)36-37-49(56)58-44-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h18-21,47,51-52H,3-17,22-46H2,1-2H3,(H,53,55)/b20-18-,21-19- |
| InChIKey | PGWJIRDMOPGUQA-AUYXYSRISA-N |
| XLogP | 11.30 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.32 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|