C42H73NO5S — CID 145219705
[1,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-1,5-dioxopentan-3-yl]carbamothioic S-acid (PubChem CID 145219705) has the molecular formula C42H73NO5S and a molecular weight of 704.11 g/mol. Its IUPAC name is [1,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-1,5-dioxopentan-3-yl]carbamothioic S-acid.
| Compound Name | [1,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-1,5-dioxopentan-3-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 145219705 |
| Molecular Formula | C42H73NO5S |
| Molecular Weight | 704.11 g/mol |
| Exact Mass | 703.52 |
| IUPAC Name | [1,5-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-1,5-dioxopentan-3-yl]carbamothioic S-acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CC(CC(=O)OCCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)S |
| InChI | InChI=1S/C42H73NO5S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-47-40(44)37-39(43-42(46)49)38-41(45)48-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,39H,3-10,15-16,21-38H2,1-2H3,(H2,43,46,49)/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | HAEHFDVPKKPQOF-MAZCIEHSSA-N |
| XLogP | 12.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.11 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|