C26H45NO6 — CID 155015583
[(9Z,12Z)-octadeca-9,12-dienyl] 3-(2-hydroxyethoxycarbonylamino)-5-oxopentanoate (PubChem CID 155015583) has the molecular formula C26H45NO6 and a molecular weight of 467.65 g/mol. Its IUPAC name is [(9Z,12Z)-octadeca-9,12-dienyl] 3-(2-hydroxyethoxycarbonylamino)-5-oxopentanoate.
| Compound Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-(2-hydroxyethoxycarbonylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 155015583 |
| Molecular Formula | C26H45NO6 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.32 |
| IUPAC Name | [(9Z,12Z)-octadeca-9,12-dienyl] 3-(2-hydroxyethoxycarbonylamino)-5-oxopentanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(=O)CC(CC=O)NC(=O)OCCO |
| InChI | InChI=1S/C26H45NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-32-25(30)23-24(18-19-28)27-26(31)33-22-20-29/h6-7,9-10,19,24,29H,2-5,8,11-18,20-23H2,1H3,(H,27,31)/b7-6-,10-9- |
| InChIKey | QXUAZPXJNIJRRX-HZJYTTRNSA-N |
| XLogP | 5.41 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|