C18H25N3O4 — CID 145219932
tert-butyl 3-aminopyrrolidine-1-carboxylate;2-methylisoindole-1,3-dione (PubChem CID 145219932) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl 3-aminopyrrolidine-1-carboxylate;2-methylisoindole-1,3-dione.
| Compound Name | tert-butyl 3-aminopyrrolidine-1-carboxylate;2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 145219932 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl 3-aminopyrrolidine-1-carboxylate;2-methylisoindole-1,3-dione |
| SMILES | CC(C)(C)OC(=O)N1CCC(N)C1.CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C9H18N2O2.C9H7NO2/c1-9(2,3)13-8(12)11-5-4-7(10)6-11;1-10-8(11)6-4-2-3-5-7(6)9(10)12/h7H,4-6,10H2,1-3H3;2-5H,1H3 |
| InChIKey | DLODSZACOBXHLP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|