C17H14ClN5O2 — CID 145222243
2-[[8-[(Z)-C-aminocarbonohydrazonoyl]-3-chloroquinolin-6-yl]methyl]pyridine-4-carboxylic acid (PubChem CID 145222243) has the molecular formula C17H14ClN5O2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 2-[[8-[(Z)-C-aminocarbonohydrazonoyl]-3-chloroquinolin-6-yl]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[8-[(Z)-C-aminocarbonohydrazonoyl]-3-chloroquinolin-6-yl]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145222243 |
| Molecular Formula | C17H14ClN5O2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 2-[[8-[(Z)-C-aminocarbonohydrazonoyl]-3-chloroquinolin-6-yl]methyl]pyridine-4-carboxylic acid |
| SMILES | N/N=C(\N)c1cc(Cc2cc(C(=O)O)ccn2)cc2cc(Cl)cnc12 |
| InChI | InChI=1S/C17H14ClN5O2/c18-12-6-11-3-9(4-13-7-10(17(24)25)1-2-21-13)5-14(16(19)23-20)15(11)22-8-12/h1-3,5-8H,4,20H2,(H2,19,23)(H,24,25) |
| InChIKey | IOIYUWCOSYZSSW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 127.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|