C40H29BF2N2O — CID 145222965
[2-[(Z)-(3,5-diphenylpyrrol-2-ylidene)-phenylmethyl]-5-(4-methoxyphenyl)-3-phenylpyrrol-1-yl]-difluoroborane (PubChem CID 145222965) has the molecular formula C40H29BF2N2O and a molecular weight of 602.49 g/mol. Its IUPAC name is [2-[(Z)-(3,5-diphenylpyrrol-2-ylidene)-phenylmethyl]-5-(4-methoxyphenyl)-3-phenylpyrrol-1-yl]-difluoroborane.
| Compound Name | [2-[(Z)-(3,5-diphenylpyrrol-2-ylidene)-phenylmethyl]-5-(4-methoxyphenyl)-3-phenylpyrrol-1-yl]-difluoroborane |
|---|---|
| PubChem CID | 145222965 |
| Molecular Formula | C40H29BF2N2O |
| Molecular Weight | 602.49 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | [2-[(Z)-(3,5-diphenylpyrrol-2-ylidene)-phenylmethyl]-5-(4-methoxyphenyl)-3-phenylpyrrol-1-yl]-difluoroborane |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(/C(=C3\N=C(c4ccccc4)C=C3c3ccccc3)c3ccccc3)n2B(F)F)cc1 |
| InChI | InChI=1S/C40H29BF2N2O/c1-46-33-24-22-31(23-25-33)37-27-35(29-16-8-3-9-17-29)40(45(37)41(42)43)38(32-20-12-5-13-21-32)39-34(28-14-6-2-7-15-28)26-36(44-39)30-18-10-4-11-19-30/h2-27H,1H3/b39-38- |
| InChIKey | ZXKYUZLPBBRPBA-OKULSNQLSA-N |
| XLogP | 9.95 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.49 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|