C12H20N2O2 — CID 145223857
ethane;5-methoxy-N,N,6-trimethylpyridine-3-carboxamide (PubChem CID 145223857) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;5-methoxy-N,N,6-trimethylpyridine-3-carboxamide.
| Compound Name | ethane;5-methoxy-N,N,6-trimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 145223857 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | ethane;5-methoxy-N,N,6-trimethylpyridine-3-carboxamide |
| SMILES | CC.COc1cc(C(=O)N(C)C)cnc1C |
| InChI | InChI=1S/C10H14N2O2.C2H6/c1-7-9(14-4)5-8(6-11-7)10(13)12(2)3;1-2/h5-6H,1-4H3;1-2H3 |
| InChIKey | CSNYESXKPXEEGH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |