C11H19N3O — CID 178150598
6-amino-N,N,5-trimethylpyridine-3-carboxamide;ethane (PubChem CID 178150598) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 6-amino-N,N,5-trimethylpyridine-3-carboxamide;ethane.
| Compound Name | 6-amino-N,N,5-trimethylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 178150598 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 6-amino-N,N,5-trimethylpyridine-3-carboxamide;ethane |
| SMILES | CC.Cc1cc(C(=O)N(C)C)cnc1N |
| InChI | InChI=1S/C9H13N3O.C2H6/c1-6-4-7(5-11-8(6)10)9(13)12(2)3;1-2/h4-5H,1-3H3,(H2,10,11);1-2H3 |
| InChIKey | JOIBHVBIAGUXNM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |