C12H18ClN5 — CID 145224442
2-chloro-4-N-cyclohexyl-6-methanimidoyl-5-N-methylpyrimidine-4,5-diamine (PubChem CID 145224442) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-chloro-4-N-cyclohexyl-6-methanimidoyl-5-N-methylpyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-cyclohexyl-6-methanimidoyl-5-N-methylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 145224442 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-chloro-4-N-cyclohexyl-6-methanimidoyl-5-N-methylpyrimidine-4,5-diamine |
| SMILES | [H]/N=C/c1nc(Cl)nc(NC2CCCCC2)c1NC |
| InChI | InChI=1S/C12H18ClN5/c1-15-10-9(7-14)17-12(13)18-11(10)16-8-5-3-2-4-6-8/h7-8,14-15H,2-6H2,1H3,(H,16,17,18)/b14-7+ |
| InChIKey | SVVNMXSQBLHJGP-VGOFMYFVSA-N |
| XLogP | 2.91 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|