C17H16ClN5O3 — CID 145225708
5-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 145225708) has the molecular formula C17H16ClN5O3 and a molecular weight of 373.80 g/mol. Its IUPAC name is 5-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | 5-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 145225708 |
| Molecular Formula | C17H16ClN5O3 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 5-chloro-1H-pyrazolo[4,3-b]pyridine-3-carboxamide;5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)CCOc2ccccc21.NC(=O)c1n[nH]c2ccc(Cl)nc12 |
| InChI | InChI=1S/C10H11NO2.C7H5ClN4O/c1-11-8-4-2-3-5-9(8)13-7-6-10(11)12;8-4-2-1-3-5(10-4)6(7(9)13)12-11-3/h2-5H,6-7H2,1H3;1-2H,(H2,9,13)(H,11,12) |
| InChIKey | HUMHZXPADSIORW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|