C26H32N2O3 — CID 145227396
2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-(3-phenylmethoxyprop-1-ynyl)-3-pyridinyl]acetic acid (PubChem CID 145227396) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-(3-phenylmethoxyprop-1-ynyl)-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-(3-phenylmethoxyprop-1-ynyl)-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 145227396 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-(3-phenylmethoxyprop-1-ynyl)-3-pyridinyl]acetic acid |
| SMILES | Cc1nc(C)c(CC(=O)O)c(N2CCC(C)(C)CC2)c1C#CCOCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O3/c1-19-22(11-8-16-31-18-21-9-6-5-7-10-21)25(23(17-24(29)30)20(2)27-19)28-14-12-26(3,4)13-15-28/h5-7,9-10H,12-18H2,1-4H3,(H,29,30) |
| InChIKey | LUYIJPUYEDOYOS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|