C15H14F2N2O3 — CID 14522756
2-acetamido-N-[(2,5-difluorophenyl)methyl]-2-(furan-2-yl)acetamide (PubChem CID 14522756) has the molecular formula C15H14F2N2O3 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-acetamido-N-[(2,5-difluorophenyl)methyl]-2-(furan-2-yl)acetamide.
| Compound Name | 2-acetamido-N-[(2,5-difluorophenyl)methyl]-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 14522756 |
| Molecular Formula | C15H14F2N2O3 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-acetamido-N-[(2,5-difluorophenyl)methyl]-2-(furan-2-yl)acetamide |
| SMILES | CC(=O)NC(C(=O)NCc1cc(F)ccc1F)c1ccco1 |
| InChI | InChI=1S/C15H14F2N2O3/c1-9(20)19-14(13-3-2-6-22-13)15(21)18-8-10-7-11(16)4-5-12(10)17/h2-7,14H,8H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | SXBRZCOVAGUKJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |