About ethane;N-(4-hydroxyphenyl)formamide;methanamine
ethane;N-(4-hydroxyphenyl)formamide;methanamine (PubChem CID 145229488) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is ethane;N-(4-hydroxyphenyl)formamide;methanamine.
Molecular Properties
| Compound Name | ethane;N-(4-hydroxyphenyl)formamide;methanamine |
| PubChem CID | 145229488 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | ethane;N-(4-hydroxyphenyl)formamide;methanamine |
| SMILES | CC.CN.O=CNc1ccc(O)cc1 |
| InChI | InChI=1S/C7H7NO2.C2H6.CH5N/c9-5-8-6-1-3-7(10)4-2-6;2*1-2/h1-5,10H,(H,8,9);1-2H3;2H2,1H3 |
| InChIKey | MKXAECCUXBUUBE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(4-hydroxyphenyl)formamide;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(4-hydroxyphenyl)formamide;methanamine?
The IUPAC name of ethane;N-(4-hydroxyphenyl)formamide;methanamine (CID 145229488) is ethane;N-(4-hydroxyphenyl)formamide;methanamine.
What is the SMILES notation for ethane;N-(4-hydroxyphenyl)formamide;methanamine?
The canonical SMILES for ethane;N-(4-hydroxyphenyl)formamide;methanamine is CC.CN.O=CNc1ccc(O)cc1.
What is the InChIKey of ethane;N-(4-hydroxyphenyl)formamide;methanamine?
The InChIKey is MKXAECCUXBUUBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6.CH5N/c9-5-8-6-1-3-7(10)4-2-6;2*1-2/h1-5,10H,(H,8,9);1-2H3;2H2,1H3.
What are the key properties of ethane;N-(4-hydroxyphenyl)formamide;methanamine?
ethane;N-(4-hydroxyphenyl)formamide;methanamine has a molecular weight of 198.27 g/mol, XLogP of 1.56, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(4-hydroxyphenyl)formamide;methanamine is sourced from PubChem (CID 145229488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).