C4H8F2N2 — CID 145229980
(E)-N'-(2,2-difluoroethyl)ethene-1,2-diamine (PubChem CID 145229980) has the molecular formula C4H8F2N2 and a molecular weight of 122.12 g/mol. Its IUPAC name is (E)-N'-(2,2-difluoroethyl)ethene-1,2-diamine.
| Compound Name | (E)-N'-(2,2-difluoroethyl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 145229980 |
| Molecular Formula | C4H8F2N2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (E)-N'-(2,2-difluoroethyl)ethene-1,2-diamine |
| SMILES | N/C=C/NCC(F)F |
| InChI | InChI=1S/C4H8F2N2/c5-4(6)3-8-2-1-7/h1-2,4,8H,3,7H2/b2-1+ |
| InChIKey | VSSDMSHLLOONSZ-OWOJBTEDSA-N |
| XLogP | 0.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |