C26H44OS — CID 145230521
(3S,17S)-17-(5-ethylsulfanylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145230521) has the molecular formula C26H44OS and a molecular weight of 404.70 g/mol. Its IUPAC name is (3S,17S)-17-(5-ethylsulfanylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,17S)-17-(5-ethylsulfanylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145230521 |
| Molecular Formula | C26H44OS |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (3S,17S)-17-(5-ethylsulfanylpentyl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCSCCCCC[C@H]1CCC2C3CC=C4C[C@@H](O)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C26H44OS/c1-4-28-17-7-5-6-8-19-10-12-23-22-11-9-20-18-21(27)13-15-26(20,3)24(22)14-16-25(19,23)2/h9,19,21-24,27H,4-8,10-18H2,1-3H3/t19-,21-,22?,23?,24?,25?,26?/m0/s1 |
| InChIKey | QWCIDPBKOKBWSV-HYMBNGDHSA-N |
| XLogP | 7.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|