C6H11F2N — CID 145230885
N-(2,2-difluoroethyl)but-1-en-2-amine (PubChem CID 145230885) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)but-1-en-2-amine.
| Compound Name | N-(2,2-difluoroethyl)but-1-en-2-amine |
|---|---|
| PubChem CID | 145230885 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | N-(2,2-difluoroethyl)but-1-en-2-amine |
| SMILES | C=C(CC)NCC(F)F |
| InChI | InChI=1S/C6H11F2N/c1-3-5(2)9-4-6(7)8/h6,9H,2-4H2,1H3 |
| InChIKey | ZLZZXZCIUQYUBM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |