About 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one
1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one (PubChem CID 145234028) has the molecular formula C22H38O
and a molecular weight of 318.55 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one.
Molecular Properties
| Compound Name | 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one |
| PubChem CID | 145234028 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one |
| SMILES | CC.CCCCC(C)=O.CCc1ccc(CC2CCCC2)cc1 |
| InChI | InChI=1S/C14H20.C6H12O.C2H6/c1-2-12-7-9-14(10-8-12)11-13-5-3-4-6-13;1-3-4-5-6(2)7;1-2/h7-10,13H,2-6,11H2,1H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | YOOUOVBYSNKFJX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one?
The IUPAC name of 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one (CID 145234028) is 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one.
What is the SMILES notation for 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one?
The canonical SMILES for 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one is CC.CCCCC(C)=O.CCc1ccc(CC2CCCC2)cc1.
What is the InChIKey of 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one?
The InChIKey is YOOUOVBYSNKFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20.C6H12O.C2H6/c1-2-12-7-9-14(10-8-12)11-13-5-3-4-6-13;1-3-4-5-6(2)7;1-2/h7-10,13H,2-6,11H2,1H3;3-5H2,1-2H3;1-2H3.
What are the key properties of 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one?
1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one has a molecular weight of 318.55 g/mol, XLogP of 6.77, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentylmethyl)-4-ethylbenzene;ethane;hexan-2-one is sourced from PubChem (CID 145234028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).