C4H8F2N2 — CID 145238362
1-(3,3-difluoroprop-1-en-2-yl)-2-methylhydrazine (PubChem CID 145238362) has the molecular formula C4H8F2N2 and a molecular weight of 122.12 g/mol. Its IUPAC name is 1-(3,3-difluoroprop-1-en-2-yl)-2-methylhydrazine.
| Compound Name | 1-(3,3-difluoroprop-1-en-2-yl)-2-methylhydrazine |
|---|---|
| PubChem CID | 145238362 |
| Molecular Formula | C4H8F2N2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1-(3,3-difluoroprop-1-en-2-yl)-2-methylhydrazine |
| SMILES | C=C(NNC)C(F)F |
| InChI | InChI=1S/C4H8F2N2/c1-3(4(5)6)8-7-2/h4,7-8H,1H2,2H3 |
| InChIKey | OGHICYZYKAQLCZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|