C22H20BF4N5S — CID 145239759
1-[N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-3-fluoroanilino]sulfanyl-1,4-azaborinane-4-carbonitrile (PubChem CID 145239759) has the molecular formula C22H20BF4N5S and a molecular weight of 473.31 g/mol. Its IUPAC name is 1-[N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-3-fluoroanilino]sulfanyl-1,4-azaborinane-4-carbonitrile.
| Compound Name | 1-[N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-3-fluoroanilino]sulfanyl-1,4-azaborinane-4-carbonitrile |
|---|---|
| PubChem CID | 145239759 |
| Molecular Formula | C22H20BF4N5S |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | 1-[N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-3-fluoroanilino]sulfanyl-1,4-azaborinane-4-carbonitrile |
| SMILES | N#CB1CCN(SN(Cc2ccc(C3=NN=C(C(F)F)C3)cc2F)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H20BF4N5S/c24-17-2-1-3-18(11-17)32(33-31-8-6-23(14-28)7-9-31)13-16-5-4-15(10-19(16)25)20-12-21(22(26)27)30-29-20/h1-5,10-11,22H,6-9,12-13H2 |
| InChIKey | QNUSUAFOYBCLOK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 54.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|