C23H26F3N5S2 — CID 145239862
N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-N-[methylidene-(4-methylsulfanylpiperazin-1-yl)-λ4-sulfanyl]aniline (PubChem CID 145239862) has the molecular formula C23H26F3N5S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-N-[methylidene-(4-methylsulfanylpiperazin-1-yl)-λ4-sulfanyl]aniline.
| Compound Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-N-[methylidene-(4-methylsulfanylpiperazin-1-yl)-λ4-sulfanyl]aniline |
|---|---|
| PubChem CID | 145239862 |
| Molecular Formula | C23H26F3N5S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-fluorophenyl]methyl]-N-[methylidene-(4-methylsulfanylpiperazin-1-yl)-λ4-sulfanyl]aniline |
| SMILES | C=S(N1CCN(SC)CC1)N(Cc1ccc(C2=NN=C(C(F)F)C2)cc1F)c1ccccc1 |
| InChI | InChI=1S/C23H26F3N5S2/c1-32-29-10-12-30(13-11-29)33(2)31(19-6-4-3-5-7-19)16-18-9-8-17(14-20(18)24)21-15-22(23(25)26)28-27-21/h3-9,14,23H,2,10-13,15-16H2,1H3 |
| InChIKey | YSFPZLUUMPYZDK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|