C19H17N4O3P — CID 145239987
[3-[[1-(oxetan-3-yl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]isoquinolin-4-yl]phosphinous acid (PubChem CID 145239987) has the molecular formula C19H17N4O3P and a molecular weight of 380.34 g/mol. Its IUPAC name is [3-[[1-(oxetan-3-yl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]isoquinolin-4-yl]phosphinous acid.
| Compound Name | [3-[[1-(oxetan-3-yl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]isoquinolin-4-yl]phosphinous acid |
|---|---|
| PubChem CID | 145239987 |
| Molecular Formula | C19H17N4O3P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | [3-[[1-(oxetan-3-yl)-2-oxoimidazo[4,5-c]pyridin-3-yl]methyl]isoquinolin-4-yl]phosphinous acid |
| SMILES | O=c1n(Cc2ncc3ccccc3c2PO)c2cnccc2n1C1COC1 |
| InChI | InChI=1S/C19H17N4O3P/c24-19-22(17-8-20-6-5-16(17)23(19)13-10-26-11-13)9-15-18(27-25)14-4-2-1-3-12(14)7-21-15/h1-8,13,25,27H,9-11H2 |
| InChIKey | REMUHYZYDHKRAT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|