C24H26N4O2 — CID 126545045
1-cyclopropyl-3-[[4-(4-hydroxybutyl)-8-methylisoquinolin-3-yl]methyl]imidazo[4,5-c]pyridin-2-one (PubChem CID 126545045) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-cyclopropyl-3-[[4-(4-hydroxybutyl)-8-methylisoquinolin-3-yl]methyl]imidazo[4,5-c]pyridin-2-one.
| Compound Name | 1-cyclopropyl-3-[[4-(4-hydroxybutyl)-8-methylisoquinolin-3-yl]methyl]imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 126545045 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-cyclopropyl-3-[[4-(4-hydroxybutyl)-8-methylisoquinolin-3-yl]methyl]imidazo[4,5-c]pyridin-2-one |
| SMILES | Cc1cccc2c(CCCCO)c(Cn3c(=O)n(C4CC4)c4ccncc43)ncc12 |
| InChI | InChI=1S/C24H26N4O2/c1-16-5-4-7-18-19(6-2-3-12-29)21(26-13-20(16)18)15-27-23-14-25-11-10-22(23)28(24(27)30)17-8-9-17/h4-5,7,10-11,13-14,17,29H,2-3,6,8-9,12,15H2,1H3 |
| InChIKey | NPHBBEIJJHGNSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|