C28H29F3N4O2 — CID 145240556
(Z)-6-methoxy-4-methylidene-1-[4-[2-[(3-methyl-3H-pyrrol-5-yl)amino]pyrimidin-5-yl]phenyl]-6-[1-(trifluoromethyl)cyclobutyl]hex-5-en-2-one (PubChem CID 145240556) has the molecular formula C28H29F3N4O2 and a molecular weight of 510.56 g/mol. Its IUPAC name is (Z)-6-methoxy-4-methylidene-1-[4-[2-[(3-methyl-3H-pyrrol-5-yl)amino]pyrimidin-5-yl]phenyl]-6-[1-(trifluoromethyl)cyclobutyl]hex-5-en-2-one.
| Compound Name | (Z)-6-methoxy-4-methylidene-1-[4-[2-[(3-methyl-3H-pyrrol-5-yl)amino]pyrimidin-5-yl]phenyl]-6-[1-(trifluoromethyl)cyclobutyl]hex-5-en-2-one |
|---|---|
| PubChem CID | 145240556 |
| Molecular Formula | C28H29F3N4O2 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (Z)-6-methoxy-4-methylidene-1-[4-[2-[(3-methyl-3H-pyrrol-5-yl)amino]pyrimidin-5-yl]phenyl]-6-[1-(trifluoromethyl)cyclobutyl]hex-5-en-2-one |
| SMILES | C=C(/C=C(\OC)C1(C(F)(F)F)CCC1)CC(=O)Cc1ccc(-c2cnc(NC3=CC(C)C=N3)nc2)cc1 |
| InChI | InChI=1S/C28H29F3N4O2/c1-18(12-24(37-3)27(9-4-10-27)28(29,30)31)11-23(36)14-20-5-7-21(8-6-20)22-16-33-26(34-17-22)35-25-13-19(2)15-32-25/h5-8,12-13,15-17,19H,1,4,9-11,14H2,2-3H3,(H,33,34,35)/b24-12- |
| InChIKey | IMLAJSHZXTUEAJ-MSXFZWOLSA-N |
| XLogP | 6.44 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|